C22H22ClNO4S — CID 11384927
ethyl (2E,4E,6E)-7-[4-[(4-chlorophenyl)sulfonylamino]phenyl]-6-methylhepta-2,4,6-trienoate (PubChem CID 11384927) has the molecular formula C22H22ClNO4S and a molecular weight of 431.94 g/mol. Its IUPAC name is ethyl (2E,4E,6E)-7-[4-[(4-chlorophenyl)sulfonylamino]phenyl]-6-methylhepta-2,4,6-trienoate.
| Compound Name | ethyl (2E,4E,6E)-7-[4-[(4-chlorophenyl)sulfonylamino]phenyl]-6-methylhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 11384927 |
| Molecular Formula | C22H22ClNO4S |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | ethyl (2E,4E,6E)-7-[4-[(4-chlorophenyl)sulfonylamino]phenyl]-6-methylhepta-2,4,6-trienoate |
| SMILES | CCOC(=O)/C=C/C=C/C(C)=C/c1ccc(NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H22ClNO4S/c1-3-28-22(25)7-5-4-6-17(2)16-18-8-12-20(13-9-18)24-29(26,27)21-14-10-19(23)11-15-21/h4-16,24H,3H2,1-2H3/b6-4+,7-5+,17-16+ |
| InChIKey | CTDYMLBJLIJCJL-LSOVFIMWSA-N |
| XLogP | 5.22 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|