C18H16ClNO4S — CID 11176374
(2E,4E)-5-[4-[(4-chlorophenyl)sulfonylamino]phenyl]-4-methylpenta-2,4-dienoic acid (PubChem CID 11176374) has the molecular formula C18H16ClNO4S and a molecular weight of 377.85 g/mol. Its IUPAC name is (2E,4E)-5-[4-[(4-chlorophenyl)sulfonylamino]phenyl]-4-methylpenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[4-[(4-chlorophenyl)sulfonylamino]phenyl]-4-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 11176374 |
| Molecular Formula | C18H16ClNO4S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | (2E,4E)-5-[4-[(4-chlorophenyl)sulfonylamino]phenyl]-4-methylpenta-2,4-dienoic acid |
| SMILES | CC(/C=C/C(=O)O)=C\c1ccc(NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H16ClNO4S/c1-13(2-11-18(21)22)12-14-3-7-16(8-4-14)20-25(23,24)17-9-5-15(19)6-10-17/h2-12,20H,1H3,(H,21,22)/b11-2+,13-12+ |
| InChIKey | HIUIHMARBRKSSO-HUYCJKDXSA-N |
| XLogP | 4.18 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|