C19H24ClNO5S — CID 54683167
tert-butyl (E)-3-[5-[(4-chlorophenyl)sulfonylamino]-2-hydroxycyclohexen-1-yl]prop-2-enoate (PubChem CID 54683167) has the molecular formula C19H24ClNO5S and a molecular weight of 413.92 g/mol. Its IUPAC name is tert-butyl (E)-3-[5-[(4-chlorophenyl)sulfonylamino]-2-hydroxycyclohexen-1-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[5-[(4-chlorophenyl)sulfonylamino]-2-hydroxycyclohexen-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 54683167 |
| Molecular Formula | C19H24ClNO5S |
| Molecular Weight | 413.92 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | tert-butyl (E)-3-[5-[(4-chlorophenyl)sulfonylamino]-2-hydroxycyclohexen-1-yl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/C1=C(O)CCC(NS(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H24ClNO5S/c1-19(2,3)26-18(23)11-4-13-12-15(7-10-17(13)22)21-27(24,25)16-8-5-14(20)6-9-16/h4-6,8-9,11,15,21-22H,7,10,12H2,1-3H3/b11-4+ |
| InChIKey | QFZCYRBMAUYOCQ-NYYWCZLTSA-N |
| XLogP | 3.88 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.92 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|