C20H21ClN2O4S — CID 55687392
N-[2-(4-chlorophenoxy)ethyl]-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 55687392) has the molecular formula C20H21ClN2O4S and a molecular weight of 420.92 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55687392 |
| Molecular Formula | C20H21ClN2O4S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(S(=O)(=O)NC2CC2)cc1)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2O4S/c21-16-4-8-18(9-5-16)27-14-13-22-20(24)12-3-15-1-10-19(11-2-15)28(25,26)23-17-6-7-17/h1-5,8-12,17,23H,6-7,13-14H2,(H,22,24) |
| InChIKey | SFUWTMLBRYGJBC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|