C21H22BrN3O4S — CID 38964102
(E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 38964102) has the molecular formula C21H22BrN3O4S and a molecular weight of 492.40 g/mol. Its IUPAC name is (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 38964102 |
| Molecular Formula | C21H22BrN3O4S |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNC(=O)/C=C/c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C21H22BrN3O4S/c1-14-12-16(22)5-10-19(14)24-21(27)13-23-20(26)11-4-15-2-8-18(9-3-15)30(28,29)25-17-6-7-17/h2-5,8-12,17,25H,6-7,13H2,1H3,(H,23,26)(H,24,27)/b11-4+ |
| InChIKey | VMCIAKXPHHHFKT-NYYWCZLTSA-N |
| XLogP | 2.97 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|