C22H25BrN2O4 — CID 26712804
(E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(3,4-diethoxyphenyl)prop-2-enamide (PubChem CID 26712804) has the molecular formula C22H25BrN2O4 and a molecular weight of 461.36 g/mol. Its IUPAC name is (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(3,4-diethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(3,4-diethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26712804 |
| Molecular Formula | C22H25BrN2O4 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(3,4-diethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)NCC(=O)Nc2ccc(Br)cc2C)cc1OCC |
| InChI | InChI=1S/C22H25BrN2O4/c1-4-28-19-10-6-16(13-20(19)29-5-2)7-11-21(26)24-14-22(27)25-18-9-8-17(23)12-15(18)3/h6-13H,4-5,14H2,1-3H3,(H,24,26)(H,25,27)/b11-7+ |
| InChIKey | GTCKGNDOVDPOQH-YRNVUSSQSA-N |
| XLogP | 4.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|