C21H22BrClN2O4 — CID 26712822
(E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enamide (PubChem CID 26712822) has the molecular formula C21H22BrClN2O4 and a molecular weight of 481.77 g/mol. Its IUPAC name is (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26712822 |
| Molecular Formula | C21H22BrClN2O4 |
| Molecular Weight | 481.77 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enamide |
| SMILES | CCOc1c(Cl)cc(/C=C/C(=O)NCC(=O)Nc2ccc(Br)cc2C)cc1OC |
| InChI | InChI=1S/C21H22BrClN2O4/c1-4-29-21-16(23)10-14(11-18(21)28-3)5-8-19(26)24-12-20(27)25-17-7-6-15(22)9-13(17)2/h5-11H,4,12H2,1-3H3,(H,24,26)(H,25,27)/b8-5+ |
| InChIKey | PPRPRPWTOBIIJD-VMPITWQZSA-N |
| XLogP | 4.59 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.77 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|