C16H21ClN2O4 — CID 9224667
(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[2-(ethylamino)-2-oxoethyl]prop-2-enamide (PubChem CID 9224667) has the molecular formula C16H21ClN2O4 and a molecular weight of 340.81 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[2-(ethylamino)-2-oxoethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[2-(ethylamino)-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9224667 |
| Molecular Formula | C16H21ClN2O4 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[2-(ethylamino)-2-oxoethyl]prop-2-enamide |
| SMILES | CCNC(=O)CNC(=O)/C=C/c1cc(Cl)c(OC)c(OCC)c1 |
| InChI | InChI=1S/C16H21ClN2O4/c1-4-18-15(21)10-19-14(20)7-6-11-8-12(17)16(22-3)13(9-11)23-5-2/h6-9H,4-5,10H2,1-3H3,(H,18,21)(H,19,20)/b7-6+ |
| InChIKey | UTWNAOHLFRIEBW-VOTSOKGWSA-N |
| XLogP | 2.01 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|