C18H25ClN2O4 — CID 8733858
(2S)-2-[[(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]amino]-N-propylpropanamide (PubChem CID 8733858) has the molecular formula C18H25ClN2O4 and a molecular weight of 368.86 g/mol. Its IUPAC name is (2S)-2-[[(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]amino]-N-propylpropanamide.
| Compound Name | (2S)-2-[[(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 8733858 |
| Molecular Formula | C18H25ClN2O4 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (2S)-2-[[(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)[C@H](C)NC(=O)/C=C/c1cc(Cl)c(OC)c(OCC)c1 |
| InChI | InChI=1S/C18H25ClN2O4/c1-5-9-20-18(23)12(3)21-16(22)8-7-13-10-14(19)17(24-4)15(11-13)25-6-2/h7-8,10-12H,5-6,9H2,1-4H3,(H,20,23)(H,21,22)/b8-7+/t12-/m0/s1 |
| InChIKey | KNLZWTBKGWOWIQ-GUOLPTJISA-N |
| XLogP | 2.79 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|