C17H24ClN3O4S — CID 9477685
1-[[(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]amino]-3-[(2S)-1-methoxypropan-2-yl]thiourea (PubChem CID 9477685) has the molecular formula C17H24ClN3O4S and a molecular weight of 401.92 g/mol. Its IUPAC name is 1-[[(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]amino]-3-[(2S)-1-methoxypropan-2-yl]thiourea.
| Compound Name | 1-[[(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]amino]-3-[(2S)-1-methoxypropan-2-yl]thiourea |
|---|---|
| PubChem CID | 9477685 |
| Molecular Formula | C17H24ClN3O4S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 1-[[(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]amino]-3-[(2S)-1-methoxypropan-2-yl]thiourea |
| SMILES | CCOc1cc(/C=C/C(=O)NNC(=S)N[C@@H](C)COC)cc(Cl)c1OC |
| InChI | InChI=1S/C17H24ClN3O4S/c1-5-25-14-9-12(8-13(18)16(14)24-4)6-7-15(22)20-21-17(26)19-11(2)10-23-3/h6-9,11H,5,10H2,1-4H3,(H,20,22)(H2,19,21,26)/b7-6+/t11-/m0/s1 |
| InChIKey | KHXJHDBGCORKOP-MLRMMBSGSA-N |
| XLogP | 2.29 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|