C22H25ClN2O4 — CID 26713690
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]prop-2-enamide (PubChem CID 26713690) has the molecular formula C22H25ClN2O4 and a molecular weight of 416.91 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 26713690 |
| Molecular Formula | C22H25ClN2O4 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCC(=O)Nc2c(C)cc(C)cc2C)cc(Cl)c1OC |
| InChI | InChI=1S/C22H25ClN2O4/c1-13-8-14(2)21(15(3)9-13)25-20(27)12-24-19(26)7-6-16-10-17(23)22(29-5)18(11-16)28-4/h6-11H,12H2,1-5H3,(H,24,26)(H,25,27)/b7-6+ |
| InChIKey | FVEUPCOUNQYVIH-VOTSOKGWSA-N |
| XLogP | 4.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|