C22H24F2N2O4 — CID 85461562
3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]prop-2-enamide (PubChem CID 85461562) has the molecular formula C22H24F2N2O4 and a molecular weight of 418.44 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]prop-2-enamide.
| Compound Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 85461562 |
| Molecular Formula | C22H24F2N2O4 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)NCC(=O)Nc2c(C)cc(C)cc2C)ccc1OC(F)F |
| InChI | InChI=1S/C22H24F2N2O4/c1-13-9-14(2)21(15(3)10-13)26-20(28)12-25-19(27)8-6-16-5-7-17(30-22(23)24)18(11-16)29-4/h5-11,22H,12H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | BBSJPNPNTVVXGL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|