C20H21ClN2O2 — CID 26713975
(E)-3-(2-chlorophenyl)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]prop-2-enamide (PubChem CID 26713975) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 26713975 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]prop-2-enamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)/C=C/c2ccccc2Cl)c(C)c1 |
| InChI | InChI=1S/C20H21ClN2O2/c1-13-10-14(2)20(15(3)11-13)23-19(25)12-22-18(24)9-8-16-6-4-5-7-17(16)21/h4-11H,12H2,1-3H3,(H,22,24)(H,23,25)/b9-8+ |
| InChIKey | GOAFPTDINALQOT-CMDGGOBGSA-N |
| XLogP | 4.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|