C19H19BrN2O2 — CID 74623628
3-(2-bromophenyl)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]prop-2-enamide (PubChem CID 74623628) has the molecular formula C19H19BrN2O2 and a molecular weight of 387.28 g/mol. Its IUPAC name is 3-(2-bromophenyl)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]prop-2-enamide.
| Compound Name | 3-(2-bromophenyl)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 74623628 |
| Molecular Formula | C19H19BrN2O2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 3-(2-bromophenyl)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]prop-2-enamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=O)C=Cc1ccccc1Br |
| InChI | InChI=1S/C19H19BrN2O2/c1-13-6-5-7-14(2)19(13)22-18(24)12-21-17(23)11-10-15-8-3-4-9-16(15)20/h3-11H,12H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | VXMCMXZZKFPTPL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|