C19H19ClN2OS — CID 6133744
(E)-3-(2-chlorophenyl)-N-[(2,4,6-trimethylphenyl)carbamothioyl]prop-2-enamide (PubChem CID 6133744) has the molecular formula C19H19ClN2OS and a molecular weight of 358.89 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[(2,4,6-trimethylphenyl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[(2,4,6-trimethylphenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 6133744 |
| Molecular Formula | C19H19ClN2OS |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[(2,4,6-trimethylphenyl)carbamothioyl]prop-2-enamide |
| SMILES | Cc1cc(C)c(NC(=S)NC(=O)/C=C/c2ccccc2Cl)c(C)c1 |
| InChI | InChI=1S/C19H19ClN2OS/c1-12-10-13(2)18(14(3)11-12)22-19(24)21-17(23)9-8-15-6-4-5-7-16(15)20/h4-11H,1-3H3,(H2,21,22,23,24)/b9-8+ |
| InChIKey | YKVCWUNXSYMAMH-CMDGGOBGSA-N |
| XLogP | 4.79 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|