C20H21BrN2O4S — CID 76879785
N-[(3-bromo-4-methoxyphenyl)methyl]-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 76879785) has the molecular formula C20H21BrN2O4S and a molecular weight of 465.37 g/mol. Its IUPAC name is N-[(3-bromo-4-methoxyphenyl)methyl]-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | N-[(3-bromo-4-methoxyphenyl)methyl]-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76879785 |
| Molecular Formula | C20H21BrN2O4S |
| Molecular Weight | 465.37 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | N-[(3-bromo-4-methoxyphenyl)methyl]-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(CNC(=O)C=Cc2ccc(S(=O)(=O)NC3CC3)cc2)cc1Br |
| InChI | InChI=1S/C20H21BrN2O4S/c1-27-19-10-4-15(12-18(19)21)13-22-20(24)11-5-14-2-8-17(9-3-14)28(25,26)23-16-6-7-16/h2-5,8-12,16,23H,6-7,13H2,1H3,(H,22,24) |
| InChIKey | KOOKPIDBROHUOJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|