C18H21N3O3S2 — CID 72688877
3-[4-(cyclopropylsulfamoyl)phenyl]-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]prop-2-enamide (PubChem CID 72688877) has the molecular formula C18H21N3O3S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 3-[4-(cyclopropylsulfamoyl)phenyl]-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]prop-2-enamide.
| Compound Name | 3-[4-(cyclopropylsulfamoyl)phenyl]-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 72688877 |
| Molecular Formula | C18H21N3O3S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 3-[4-(cyclopropylsulfamoyl)phenyl]-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]prop-2-enamide |
| SMILES | CCc1nc(CNC(=O)C=Cc2ccc(S(=O)(=O)NC3CC3)cc2)cs1 |
| InChI | InChI=1S/C18H21N3O3S2/c1-2-18-20-15(12-25-18)11-19-17(22)10-5-13-3-8-16(9-4-13)26(23,24)21-14-6-7-14/h3-5,8-10,12,14,21H,2,6-7,11H2,1H3,(H,19,22) |
| InChIKey | KGBNOMAUVCIJDF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|