C18H22N2OS — CID 108760236
(E)-3-(4-tert-butylphenyl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]prop-2-enamide (PubChem CID 108760236) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-tert-butylphenyl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 108760236 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]prop-2-enamide |
| SMILES | Cc1nc(CNC(=O)/C=C/c2ccc(C(C)(C)C)cc2)cs1 |
| InChI | InChI=1S/C18H22N2OS/c1-13-20-16(12-22-13)11-19-17(21)10-7-14-5-8-15(9-6-14)18(2,3)4/h5-10,12H,11H2,1-4H3,(H,19,21)/b10-7+ |
| InChIKey | QDPGUCNAKUNKQT-JXMROGBWSA-N |
| XLogP | 4.08 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|