C20H21BrN2O3 — CID 46649376
(E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide (PubChem CID 46649376) has the molecular formula C20H21BrN2O3 and a molecular weight of 417.30 g/mol. Its IUPAC name is (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 46649376 |
| Molecular Formula | C20H21BrN2O3 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNC(=O)/C=C/c1ccc(C2CC2C)o1 |
| InChI | InChI=1S/C20H21BrN2O3/c1-12-10-16(12)18-7-4-15(26-18)5-8-19(24)22-11-20(25)23-17-6-3-14(21)9-13(17)2/h3-9,12,16H,10-11H2,1-2H3,(H,22,24)(H,23,25)/b8-5+ |
| InChIKey | UBCHXUGNYWFRPF-VMPITWQZSA-N |
| XLogP | 4.24 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|