C19H21NO2 — CID 18277233
(E)-N-(2,5-dimethylphenyl)-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide (PubChem CID 18277233) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is (E)-N-(2,5-dimethylphenyl)-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(2,5-dimethylphenyl)-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 18277233 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (E)-N-(2,5-dimethylphenyl)-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(C)c(NC(=O)/C=C/c2ccc(C3CC3C)o2)c1 |
| InChI | InChI=1S/C19H21NO2/c1-12-4-5-13(2)17(10-12)20-19(21)9-7-15-6-8-18(22-15)16-11-14(16)3/h4-10,14,16H,11H2,1-3H3,(H,20,21)/b9-7+ |
| InChIKey | BSUZWONFBJDURE-VQHVLOKHSA-N |
| XLogP | 4.67 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|