C17H23BrN2O3S — CID 139697175
(Z)-6-[(1R,3S)-3-[(4-bromophenyl)sulfonylamino]cyclopentyl]hex-5-enamide (PubChem CID 139697175) has the molecular formula C17H23BrN2O3S and a molecular weight of 415.35 g/mol. Its IUPAC name is (Z)-6-[(1R,3S)-3-[(4-bromophenyl)sulfonylamino]cyclopentyl]hex-5-enamide.
| Compound Name | (Z)-6-[(1R,3S)-3-[(4-bromophenyl)sulfonylamino]cyclopentyl]hex-5-enamide |
|---|---|
| PubChem CID | 139697175 |
| Molecular Formula | C17H23BrN2O3S |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | (Z)-6-[(1R,3S)-3-[(4-bromophenyl)sulfonylamino]cyclopentyl]hex-5-enamide |
| SMILES | NC(=O)CCC/C=C\[C@@H]1CC[C@H](NS(=O)(=O)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C17H23BrN2O3S/c18-14-7-10-16(11-8-14)24(22,23)20-15-9-6-13(12-15)4-2-1-3-5-17(19)21/h2,4,7-8,10-11,13,15,20H,1,3,5-6,9,12H2,(H2,19,21)/b4-2-/t13-,15+/m1/s1 |
| InChIKey | XEZJXSODRVRQKW-GOXQEFCWSA-N |
| XLogP | 3.11 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|