C20H28BrNO3S — CID 70396543
4-bromo-N-[[3-[(Z)-6-hydroxyhex-1-enyl]-2-bicyclo[2.2.1]heptanyl]methyl]benzenesulfonamide (PubChem CID 70396543) has the molecular formula C20H28BrNO3S and a molecular weight of 442.42 g/mol. Its IUPAC name is 4-bromo-N-[[3-[(Z)-6-hydroxyhex-1-enyl]-2-bicyclo[2.2.1]heptanyl]methyl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[[3-[(Z)-6-hydroxyhex-1-enyl]-2-bicyclo[2.2.1]heptanyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70396543 |
| Molecular Formula | C20H28BrNO3S |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 4-bromo-N-[[3-[(Z)-6-hydroxyhex-1-enyl]-2-bicyclo[2.2.1]heptanyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1C2CCC(C2)C1/C=C\CCCCO)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H28BrNO3S/c21-17-8-10-18(11-9-17)26(24,25)22-14-20-16-7-6-15(13-16)19(20)5-3-1-2-4-12-23/h3,5,8-11,15-16,19-20,22-23H,1-2,4,6-7,12-14H2/b5-3- |
| InChIKey | HCSXEDKCZGMUGE-HYXAFXHYSA-N |
| XLogP | 4.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|