C19H24BrNO4S — CID 139764636
(Z)-6-[(1R,2R,3S,4S)-3-[(3-bromophenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid (PubChem CID 139764636) has the molecular formula C19H24BrNO4S and a molecular weight of 442.38 g/mol. Its IUPAC name is (Z)-6-[(1R,2R,3S,4S)-3-[(3-bromophenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(1R,2R,3S,4S)-3-[(3-bromophenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 139764636 |
| Molecular Formula | C19H24BrNO4S |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | (Z)-6-[(1R,2R,3S,4S)-3-[(3-bromophenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\[C@H]1[C@@H]2CC[C@@H](C2)[C@@H]1NS(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H24BrNO4S/c20-15-5-4-6-16(12-15)26(24,25)21-19-14-10-9-13(11-14)17(19)7-2-1-3-8-18(22)23/h2,4-7,12-14,17,19,21H,1,3,8-11H2,(H,22,23)/b7-2-/t13-,14+,17+,19+/m1/s1 |
| InChIKey | NKPIXZCACXHOEV-HEFXLBMTSA-N |
| XLogP | 3.95 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|