C26H29NO6S — CID 10939814
(Z)-7-[(1S,2R,3R,4R)-3-[(2-hydroxydibenzofuran-3-yl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 10939814) has the molecular formula C26H29NO6S and a molecular weight of 483.59 g/mol. Its IUPAC name is (Z)-7-[(1S,2R,3R,4R)-3-[(2-hydroxydibenzofuran-3-yl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2R,3R,4R)-3-[(2-hydroxydibenzofuran-3-yl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 10939814 |
| Molecular Formula | C26H29NO6S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | (Z)-7-[(1S,2R,3R,4R)-3-[(2-hydroxydibenzofuran-3-yl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@H]2CC[C@H](C2)[C@H]1NS(=O)(=O)c1cc2oc3ccccc3c2cc1O |
| InChI | InChI=1S/C26H29NO6S/c28-21-14-20-19-8-5-6-9-22(19)33-23(20)15-24(21)34(31,32)27-26-17-12-11-16(13-17)18(26)7-3-1-2-4-10-25(29)30/h1,3,5-6,8-9,14-18,26-28H,2,4,7,10-13H2,(H,29,30)/b3-1-/t16-,17+,18+,26+/m0/s1 |
| InChIKey | YMDHGJBWPUGMTQ-VUPARXMVSA-N |
| XLogP | 5.19 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|