C27H33NO5S — CID 10928987
(Z)-7-[(1S,2R,3R,4R)-3-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 10928987) has the molecular formula C27H33NO5S and a molecular weight of 483.63 g/mol. Its IUPAC name is (Z)-7-[(1S,2R,3R,4R)-3-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2R,3R,4R)-3-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 10928987 |
| Molecular Formula | C27H33NO5S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | (Z)-7-[(1S,2R,3R,4R)-3-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | COc1ccc(-c2ccc(S(=O)(=O)N[C@@H]3[C@@H]4CC[C@@H](C4)[C@H]3C/C=C\CCCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C27H33NO5S/c1-33-23-14-10-19(11-15-23)20-12-16-24(17-13-20)34(31,32)28-27-22-9-8-21(18-22)25(27)6-4-2-3-5-7-26(29)30/h2,4,10-17,21-22,25,27-28H,3,5-9,18H2,1H3,(H,29,30)/b4-2-/t21-,22+,25+,27+/m0/s1 |
| InChIKey | SEIPOYUYMPTWEN-GYXFMLPCSA-N |
| XLogP | 5.26 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|