C19H23NO6S — CID 54196660
4-[[3-(4-carboxybut-2-enyl)-2-bicyclo[2.2.1]heptanyl]sulfamoyl]benzoic acid (PubChem CID 54196660) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is 4-[[3-(4-carboxybut-2-enyl)-2-bicyclo[2.2.1]heptanyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[[3-(4-carboxybut-2-enyl)-2-bicyclo[2.2.1]heptanyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 54196660 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 4-[[3-(4-carboxybut-2-enyl)-2-bicyclo[2.2.1]heptanyl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)CC=CCC1C2CCC(C2)C1NS(=O)(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H23NO6S/c21-17(22)4-2-1-3-16-13-5-6-14(11-13)18(16)20-27(25,26)15-9-7-12(8-10-15)19(23)24/h1-2,7-10,13-14,16,18,20H,3-6,11H2,(H,21,22)(H,23,24) |
| InChIKey | PMHHKGKSYOXRIB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|