C14H18N2O2S — CID 104600135
4-amino-N-(3-tricyclo[3.2.1.02,4]octanyl)benzenesulfonamide (PubChem CID 104600135) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 4-amino-N-(3-tricyclo[3.2.1.02,4]octanyl)benzenesulfonamide.
| Compound Name | 4-amino-N-(3-tricyclo[3.2.1.02,4]octanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 104600135 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 4-amino-N-(3-tricyclo[3.2.1.02,4]octanyl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NC2C3C4CCC(C4)C23)cc1 |
| InChI | InChI=1S/C14H18N2O2S/c15-10-3-5-11(6-4-10)19(17,18)16-14-12-8-1-2-9(7-8)13(12)14/h3-6,8-9,12-14,16H,1-2,7,15H2 |
| InChIKey | RRTWVUXLUHYUTD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|