C15H16N2O2S — CID 103765723
4-cyano-N-(3-tricyclo[3.2.1.02,4]octanyl)benzenesulfonamide (PubChem CID 103765723) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 4-cyano-N-(3-tricyclo[3.2.1.02,4]octanyl)benzenesulfonamide.
| Compound Name | 4-cyano-N-(3-tricyclo[3.2.1.02,4]octanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103765723 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-cyano-N-(3-tricyclo[3.2.1.02,4]octanyl)benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NC2C3C4CCC(C4)C23)cc1 |
| InChI | InChI=1S/C15H16N2O2S/c16-8-9-1-5-12(6-2-9)20(18,19)17-15-13-10-3-4-11(7-10)14(13)15/h1-2,5-6,10-11,13-15,17H,3-4,7H2 |
| InChIKey | QBVMSBKIPTYWDT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |