C21H29N5O2S — CID 67870858
4-methyl-N-[(1S,2S,3S,4R)-3-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]-2-bicyclo[2.2.1]heptanyl]benzenesulfonamide (PubChem CID 67870858) has the molecular formula C21H29N5O2S and a molecular weight of 415.56 g/mol. Its IUPAC name is 4-methyl-N-[(1S,2S,3S,4R)-3-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]-2-bicyclo[2.2.1]heptanyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(1S,2S,3S,4R)-3-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]-2-bicyclo[2.2.1]heptanyl]benzenesulfonamide |
|---|---|
| PubChem CID | 67870858 |
| Molecular Formula | C21H29N5O2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 4-methyl-N-[(1S,2S,3S,4R)-3-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]-2-bicyclo[2.2.1]heptanyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2[C@H]3CC[C@H](C3)[C@@H]2C/C=C\CCCc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C21H29N5O2S/c1-15-8-12-18(13-9-15)29(27,28)24-21-17-11-10-16(14-17)19(21)6-4-2-3-5-7-20-22-25-26-23-20/h2,4,8-9,12-13,16-17,19,21,24H,3,5-7,10-11,14H2,1H3,(H,22,23,25,26)/b4-2-/t16-,17+,19+,21+/m1/s1 |
| InChIKey | AIURKEKMNPDRDS-OBFHWUFDSA-N |
| XLogP | 3.17 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|