C28H35N5O2S — CID 67871775
N-[(1R,2R,3S,5S)-6,6-dimethyl-3-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]-2-bicyclo[3.1.1]heptanyl]-4-phenylbenzenesulfonamide (PubChem CID 67871775) has the molecular formula C28H35N5O2S and a molecular weight of 505.69 g/mol. Its IUPAC name is N-[(1R,2R,3S,5S)-6,6-dimethyl-3-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]-2-bicyclo[3.1.1]heptanyl]-4-phenylbenzenesulfonamide.
| Compound Name | N-[(1R,2R,3S,5S)-6,6-dimethyl-3-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]-2-bicyclo[3.1.1]heptanyl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 67871775 |
| Molecular Formula | C28H35N5O2S |
| Molecular Weight | 505.69 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | N-[(1R,2R,3S,5S)-6,6-dimethyl-3-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]-2-bicyclo[3.1.1]heptanyl]-4-phenylbenzenesulfonamide |
| SMILES | CC1(C)[C@H]2C[C@H](C/C=C\CCCc3nn[nH]n3)[C@@H](NS(=O)(=O)c3ccc(-c4ccccc4)cc3)[C@@H]1C2 |
| InChI | InChI=1S/C28H35N5O2S/c1-28(2)23-18-22(12-6-3-4-9-13-26-29-32-33-30-26)27(25(28)19-23)31-36(34,35)24-16-14-21(15-17-24)20-10-7-5-8-11-20/h3,5-8,10-11,14-17,22-23,25,27,31H,4,9,12-13,18-19H2,1-2H3,(H,29,30,32,33)/b6-3-/t22-,23-,25-,27+/m0/s1 |
| InChIKey | GIRVQOLMTBONAA-OTIHXWACSA-N |
| XLogP | 5.16 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.69 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|