C24H35NO4S — CID 14396193
(E)-7-[2-[(4-ethylphenyl)sulfonylamino]-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid (PubChem CID 14396193) has the molecular formula C24H35NO4S and a molecular weight of 433.61 g/mol. Its IUPAC name is (E)-7-[2-[(4-ethylphenyl)sulfonylamino]-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid.
| Compound Name | (E)-7-[2-[(4-ethylphenyl)sulfonylamino]-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 14396193 |
| Molecular Formula | C24H35NO4S |
| Molecular Weight | 433.61 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | (E)-7-[2-[(4-ethylphenyl)sulfonylamino]-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
| SMILES | CCc1ccc(S(=O)(=O)NC2C(C/C=C/CCCC(=O)O)CC3CC2C3(C)C)cc1 |
| InChI | InChI=1S/C24H35NO4S/c1-4-17-11-13-20(14-12-17)30(28,29)25-23-18(9-7-5-6-8-10-22(26)27)15-19-16-21(23)24(19,2)3/h5,7,11-14,18-19,21,23,25H,4,6,8-10,15-16H2,1-3H3,(H,26,27)/b7-5+ |
| InChIKey | HDQIQAKHFHUGIZ-FNORWQNLSA-N |
| XLogP | 4.78 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|