C18H28O3 — CID 57096829
7-[(3S)-2-acetyl-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid (PubChem CID 57096829) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 7-[(3S)-2-acetyl-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid.
| Compound Name | 7-[(3S)-2-acetyl-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57096829 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 7-[(3S)-2-acetyl-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
| SMILES | CC(=O)C1C2CC(C[C@@H]1CC=CCCCC(=O)O)C2(C)C |
| InChI | InChI=1S/C18H28O3/c1-12(19)17-13(8-6-4-5-7-9-16(20)21)10-14-11-15(17)18(14,2)3/h4,6,13-15,17H,5,7-11H2,1-3H3,(H,20,21)/t13-,14?,15?,17?/m0/s1 |
| InChIKey | KJBJBFSBIUNXNQ-DPGVGJJJSA-N |
| XLogP | 4.07 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|