C20H35NO2 — CID 59889995
N-[(1S,3S,5R)-3-[(Z)-7-hydroxyhept-2-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]butanamide (PubChem CID 59889995) has the molecular formula C20H35NO2 and a molecular weight of 321.51 g/mol. Its IUPAC name is N-[(1S,3S,5R)-3-[(Z)-7-hydroxyhept-2-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]butanamide.
| Compound Name | N-[(1S,3S,5R)-3-[(Z)-7-hydroxyhept-2-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]butanamide |
|---|---|
| PubChem CID | 59889995 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | N-[(1S,3S,5R)-3-[(Z)-7-hydroxyhept-2-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]butanamide |
| SMILES | CCCC(=O)NC1[C@@H](C/C=C\CCCCO)C[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C20H35NO2/c1-4-10-18(23)21-19-15(11-8-6-5-7-9-12-22)13-16-14-17(19)20(16,2)3/h6,8,15-17,19,22H,4-5,7,9-14H2,1-3H3,(H,21,23)/b8-6-/t15-,16+,17+,19?/m0/s1 |
| InChIKey | QJGRKGPGBDEPKO-ZDIJZAICSA-N |
| XLogP | 4.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|