C22H30NNaO4S — CID 67871779
sodium (Z)-7-[2-(benzenesulfonamido)-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoate (PubChem CID 67871779) has the molecular formula C22H30NNaO4S and a molecular weight of 427.54 g/mol. Its IUPAC name is sodium (Z)-7-[2-(benzenesulfonamido)-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoate.
| Compound Name | sodium (Z)-7-[2-(benzenesulfonamido)-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoate |
|---|---|
| PubChem CID | 67871779 |
| Molecular Formula | C22H30NNaO4S |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | sodium (Z)-7-[2-(benzenesulfonamido)-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoate |
| SMILES | CC1(C)C2CC(C/C=C\CCCC(=O)[O-])C(NS(=O)(=O)c3ccccc3)C1C2.[Na+] |
| InChI | InChI=1S/C22H31NO4S.Na/c1-22(2)17-14-16(10-6-3-4-9-13-20(24)25)21(19(22)15-17)23-28(26,27)18-11-7-5-8-12-18;/h3,5-8,11-12,16-17,19,21,23H,4,9-10,13-15H2,1-2H3,(H,24,25);/q;+1/p-1/b6-3-; |
| InChIKey | YQCPVDDRJFZRNI-AQPBACSKSA-M |
| XLogP | -0.11 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|