C21H30N2O2S — CID 11728477
N-[(1R,2R,3S,5S)-3-[(Z)-7-amino-7-oxohept-2-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]thiophene-3-carboxamide (PubChem CID 11728477) has the molecular formula C21H30N2O2S and a molecular weight of 374.55 g/mol. Its IUPAC name is N-[(1R,2R,3S,5S)-3-[(Z)-7-amino-7-oxohept-2-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]thiophene-3-carboxamide.
| Compound Name | N-[(1R,2R,3S,5S)-3-[(Z)-7-amino-7-oxohept-2-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 11728477 |
| Molecular Formula | C21H30N2O2S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-[(1R,2R,3S,5S)-3-[(Z)-7-amino-7-oxohept-2-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]thiophene-3-carboxamide |
| SMILES | CC1(C)[C@H]2C[C@H](C/C=C\CCCC(N)=O)[C@@H](NC(=O)c3ccsc3)[C@@H]1C2 |
| InChI | InChI=1S/C21H30N2O2S/c1-21(2)16-11-14(7-5-3-4-6-8-18(22)24)19(17(21)12-16)23-20(25)15-9-10-26-13-15/h3,5,9-10,13-14,16-17,19H,4,6-8,11-12H2,1-2H3,(H2,22,24)(H,23,25)/b5-3-/t14-,16-,17-,19+/m0/s1 |
| InChIKey | XAMKVUJSYOLUEK-KRPAXRBOSA-N |
| XLogP | 4.13 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|