C25H31NO3S — CID 91431782
7-[(1S,2R,3R,5R)-3-(1-benzothiophene-3-carbonylamino)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid (PubChem CID 91431782) has the molecular formula C25H31NO3S and a molecular weight of 425.59 g/mol. Its IUPAC name is 7-[(1S,2R,3R,5R)-3-(1-benzothiophene-3-carbonylamino)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid.
| Compound Name | 7-[(1S,2R,3R,5R)-3-(1-benzothiophene-3-carbonylamino)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91431782 |
| Molecular Formula | C25H31NO3S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 7-[(1S,2R,3R,5R)-3-(1-benzothiophene-3-carbonylamino)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
| SMILES | CC1(C)[C@H]2C[C@@H](NC(=O)c3csc4ccccc34)[C@H](CC=CCCCC(=O)O)[C@@H]1C2 |
| InChI | InChI=1S/C25H31NO3S/c1-25(2)16-13-20(25)18(10-5-3-4-6-12-23(27)28)21(14-16)26-24(29)19-15-30-22-11-8-7-9-17(19)22/h3,5,7-9,11,15-16,18,20-21H,4,6,10,12-14H2,1-2H3,(H,26,29)(H,27,28)/t16-,18-,20+,21-/m1/s1 |
| InChIKey | KCPWNTCCXPFKNE-FRTACKCFSA-N |
| XLogP | 5.88 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|