C23H26FNO3S — CID 139882895
(Z)-7-[(1R,2S,3S,4S)-3-[(5-fluoro-1-benzothiophene-3-carbonyl)amino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 139882895) has the molecular formula C23H26FNO3S and a molecular weight of 415.53 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,3S,4S)-3-[(5-fluoro-1-benzothiophene-3-carbonyl)amino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,3S,4S)-3-[(5-fluoro-1-benzothiophene-3-carbonyl)amino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 139882895 |
| Molecular Formula | C23H26FNO3S |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (Z)-7-[(1R,2S,3S,4S)-3-[(5-fluoro-1-benzothiophene-3-carbonyl)amino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@@H]2CC[C@@H](C2)[C@@H]1NC(=O)c1csc2ccc(F)cc12 |
| InChI | InChI=1S/C23H26FNO3S/c24-16-9-10-20-18(12-16)19(13-29-20)23(28)25-22-15-8-7-14(11-15)17(22)5-3-1-2-4-6-21(26)27/h1,3,9-10,12-15,17,22H,2,4-8,11H2,(H,25,28)(H,26,27)/b3-1-/t14-,15+,17+,22+/m1/s1 |
| InChIKey | OMMUBLYEIVYEBY-MIQSNPJRSA-N |
| XLogP | 5.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|