C23H29FN2O3 — CID 57089380
7-[3-[[(4-fluorobenzoyl)hydrazinylidene]methyl]-2-bicyclo[2.2.2]octanyl]hept-5-enoic acid (PubChem CID 57089380) has the molecular formula C23H29FN2O3 and a molecular weight of 400.49 g/mol. Its IUPAC name is 7-[3-[[(4-fluorobenzoyl)hydrazinylidene]methyl]-2-bicyclo[2.2.2]octanyl]hept-5-enoic acid.
| Compound Name | 7-[3-[[(4-fluorobenzoyl)hydrazinylidene]methyl]-2-bicyclo[2.2.2]octanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57089380 |
| Molecular Formula | C23H29FN2O3 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 7-[3-[[(4-fluorobenzoyl)hydrazinylidene]methyl]-2-bicyclo[2.2.2]octanyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CCC1C2CCC(CC2)C1C=NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H29FN2O3/c24-19-13-11-18(12-14-19)23(29)26-25-15-21-17-9-7-16(8-10-17)20(21)5-3-1-2-4-6-22(27)28/h1,3,11-17,20-21H,2,4-10H2,(H,26,29)(H,27,28) |
| InChIKey | XRJJFKGDZTXQAX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|