C23H30O3 — CID 57211571
7-[(1R,2R,3R,4S)-3-(3-hydroxy-3-phenylprop-1-enyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 57211571) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is 7-[(1R,2R,3R,4S)-3-(3-hydroxy-3-phenylprop-1-enyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,4S)-3-(3-hydroxy-3-phenylprop-1-enyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57211571 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 7-[(1R,2R,3R,4S)-3-(3-hydroxy-3-phenylprop-1-enyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1[C@@H]2CC[C@@H](C2)[C@@H]1C=CC(O)c1ccccc1 |
| InChI | InChI=1S/C23H30O3/c24-22(17-8-4-3-5-9-17)15-14-21-19-13-12-18(16-19)20(21)10-6-1-2-7-11-23(25)26/h1,3-6,8-9,14-15,18-22,24H,2,7,10-13,16H2,(H,25,26)/t18-,19+,20-,21+,22?/m1/s1 |
| InChIKey | ADOAYMGABMBHPR-VAIUHQNPSA-N |
| XLogP | 5.14 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|