C20H26O3S — CID 70435075
(Z)-7-[(3R,4S)-4-[(E)-3-hydroxy-3-phenylprop-1-enyl]thiolan-3-yl]hept-5-enoic acid (PubChem CID 70435075) has the molecular formula C20H26O3S and a molecular weight of 346.49 g/mol. Its IUPAC name is (Z)-7-[(3R,4S)-4-[(E)-3-hydroxy-3-phenylprop-1-enyl]thiolan-3-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(3R,4S)-4-[(E)-3-hydroxy-3-phenylprop-1-enyl]thiolan-3-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70435075 |
| Molecular Formula | C20H26O3S |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (Z)-7-[(3R,4S)-4-[(E)-3-hydroxy-3-phenylprop-1-enyl]thiolan-3-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1CSC[C@H]1/C=C/C(O)c1ccccc1 |
| InChI | InChI=1S/C20H26O3S/c21-19(16-8-5-3-6-9-16)13-12-18-15-24-14-17(18)10-4-1-2-7-11-20(22)23/h1,3-6,8-9,12-13,17-19,21H,2,7,10-11,14-15H2,(H,22,23)/b4-1-,13-12+/t17-,18+,19?/m0/s1 |
| InChIKey | IRUFTDRHYDZCEO-SFMMZZAYSA-N |
| XLogP | 4.46 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|