C25H34O5 — CID 71449046
(Z)-7-[(1R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-3-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]prop-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 71449046) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is (Z)-7-[(1R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-3-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]prop-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-3-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]prop-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 71449046 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (Z)-7-[(1R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-3-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]prop-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1C(/C=C/[C@H](O)[C@H]2CCc3ccccc3C2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C25H34O5/c26-22(19-12-11-17-7-5-6-8-18(17)15-19)14-13-21-20(23(27)16-24(21)28)9-3-1-2-4-10-25(29)30/h1,3,5-8,13-14,19-24,26-28H,2,4,9-12,15-16H2,(H,29,30)/b3-1-,14-13+/t19-,20+,21?,22-,23-,24+/m0/s1 |
| InChIKey | AQMJVYYYPSOXRI-VPCJVQSOSA-N |
| XLogP | 3.27 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|