C23H27FO5 — CID 70615118
(Z)-7-[(1R,2R,3R,5S)-2-[(E)-5-(2-fluorophenyl)-3-hydroxypent-1-en-4-ynyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid (PubChem CID 70615118) has the molecular formula C23H27FO5 and a molecular weight of 402.46 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-2-[(E)-5-(2-fluorophenyl)-3-hydroxypent-1-en-4-ynyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E)-5-(2-fluorophenyl)-3-hydroxypent-1-en-4-ynyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70615118 |
| Molecular Formula | C23H27FO5 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E)-5-(2-fluorophenyl)-3-hydroxypent-1-en-4-ynyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](/C=C/C(O)C#Cc2ccccc2F)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H27FO5/c24-20-9-6-5-7-16(20)11-12-17(25)13-14-19-18(21(26)15-22(19)27)8-3-1-2-4-10-23(28)29/h1,3,5-7,9,13-14,17-19,21-22,25-27H,2,4,8,10,15H2,(H,28,29)/b3-1-,14-13+/t17?,18-,19-,21+,22-/m1/s1 |
| InChIKey | SNHFUMQXOHIUOO-FVYUVGRYSA-N |
| XLogP | 2.65 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|