C22H30O3S — CID 57320198
7-[(3R,4S)-4-(3-hydroxy-4-phenylpent-1-enyl)thiolan-3-yl]hept-5-enoic acid (PubChem CID 57320198) has the molecular formula C22H30O3S and a molecular weight of 374.55 g/mol. Its IUPAC name is 7-[(3R,4S)-4-(3-hydroxy-4-phenylpent-1-enyl)thiolan-3-yl]hept-5-enoic acid.
| Compound Name | 7-[(3R,4S)-4-(3-hydroxy-4-phenylpent-1-enyl)thiolan-3-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57320198 |
| Molecular Formula | C22H30O3S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 7-[(3R,4S)-4-(3-hydroxy-4-phenylpent-1-enyl)thiolan-3-yl]hept-5-enoic acid |
| SMILES | CC(c1ccccc1)C(O)C=C[C@@H]1CSC[C@@H]1CC=CCCCC(=O)O |
| InChI | InChI=1S/C22H30O3S/c1-17(18-9-6-4-7-10-18)21(23)14-13-20-16-26-15-19(20)11-5-2-3-8-12-22(24)25/h2,4-7,9-10,13-14,17,19-21,23H,3,8,11-12,15-16H2,1H3,(H,24,25)/t17?,19-,20+,21?/m0/s1 |
| InChIKey | UTFWIXMOCAGIAT-PXMFUHLKSA-N |
| XLogP | 4.89 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|