C25H36O3 — CID 57158350
7-[(1R,2R,3S,4S)-3-(3-hydroxy-4-phenylpentyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 57158350) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is 7-[(1R,2R,3S,4S)-3-(3-hydroxy-4-phenylpentyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3S,4S)-3-(3-hydroxy-4-phenylpentyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57158350 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 7-[(1R,2R,3S,4S)-3-(3-hydroxy-4-phenylpentyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | CC(c1ccccc1)C(O)CC[C@H]1[C@H]2CC[C@H](C2)[C@H]1CC=CCCCC(=O)O |
| InChI | InChI=1S/C25H36O3/c1-18(19-9-5-4-6-10-19)24(26)16-15-23-21-14-13-20(17-21)22(23)11-7-2-3-8-12-25(27)28/h2,4-7,9-10,18,20-24,26H,3,8,11-17H2,1H3,(H,27,28)/t18?,20-,21+,22-,23+,24?/m1/s1 |
| InChIKey | XUQJTMITKHTKDK-NWKGRHEGSA-N |
| XLogP | 5.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|