C23H32O2S — CID 70429726
(Z)-7-[(1S,2S,3R,4R)-3-(2-benzylsulfanylethyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 70429726) has the molecular formula C23H32O2S and a molecular weight of 372.57 g/mol. Its IUPAC name is (Z)-7-[(1S,2S,3R,4R)-3-(2-benzylsulfanylethyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2S,3R,4R)-3-(2-benzylsulfanylethyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70429726 |
| Molecular Formula | C23H32O2S |
| Molecular Weight | 372.57 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (Z)-7-[(1S,2S,3R,4R)-3-(2-benzylsulfanylethyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@H]2CC[C@H](C2)[C@H]1CCSCc1ccccc1 |
| InChI | InChI=1S/C23H32O2S/c24-23(25)11-7-2-1-6-10-21-19-12-13-20(16-19)22(21)14-15-26-17-18-8-4-3-5-9-18/h1,3-6,8-9,19-22H,2,7,10-17H2,(H,24,25)/b6-1-/t19-,20+,21-,22+/m0/s1 |
| InChIKey | PAFGAICBTJNXGX-KSTRXVSWSA-N |
| XLogP | 6.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.57 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|