C29H40O2S — CID 54418401
7-[(1S,2S,3R,4R)-3-(8-phenyloct-5-ynylsulfanylmethyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 54418401) has the molecular formula C29H40O2S and a molecular weight of 452.70 g/mol. Its IUPAC name is 7-[(1S,2S,3R,4R)-3-(8-phenyloct-5-ynylsulfanylmethyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | 7-[(1S,2S,3R,4R)-3-(8-phenyloct-5-ynylsulfanylmethyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54418401 |
| Molecular Formula | C29H40O2S |
| Molecular Weight | 452.70 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 7-[(1S,2S,3R,4R)-3-(8-phenyloct-5-ynylsulfanylmethyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1[C@H]2CC[C@H](C2)[C@H]1CSCCCCC#CCCc1ccccc1 |
| InChI | InChI=1S/C29H40O2S/c30-29(31)18-12-5-4-11-17-27-25-19-20-26(22-25)28(27)23-32-21-13-6-2-1-3-8-14-24-15-9-7-10-16-24/h4,7,9-11,15-16,25-28H,2,5-6,8,12-14,17-23H2,(H,30,31)/t25-,26+,27-,28+/m0/s1 |
| InChIKey | VZBRZXUYVRFGNE-ZVBOOHQUSA-N |
| XLogP | 7.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.70 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|