C21H30O4S2 — CID 90760295
7-[(1R,5R)-2-hydroxy-5-[(3R)-3-hydroxy-4-(5-methylthiophen-2-yl)sulfanylbut-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 90760295) has the molecular formula C21H30O4S2 and a molecular weight of 410.60 g/mol. Its IUPAC name is 7-[(1R,5R)-2-hydroxy-5-[(3R)-3-hydroxy-4-(5-methylthiophen-2-yl)sulfanylbut-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,5R)-2-hydroxy-5-[(3R)-3-hydroxy-4-(5-methylthiophen-2-yl)sulfanylbut-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 90760295 |
| Molecular Formula | C21H30O4S2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 7-[(1R,5R)-2-hydroxy-5-[(3R)-3-hydroxy-4-(5-methylthiophen-2-yl)sulfanylbut-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | Cc1ccc(SC[C@H](O)C=C[C@H]2CCC(O)[C@@H]2CC=CCCCC(=O)O)s1 |
| InChI | InChI=1S/C21H30O4S2/c1-15-8-13-21(27-15)26-14-17(22)11-9-16-10-12-19(23)18(16)6-4-2-3-5-7-20(24)25/h2,4,8-9,11,13,16-19,22-23H,3,5-7,10,12,14H2,1H3,(H,24,25)/t16-,17+,18+,19?/m0/s1 |
| InChIKey | RHCJYEGIZSSXSM-JCIRIWACSA-N |
| XLogP | 4.65 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|