C18H23F2NO4S — CID 15018459
(Z)-7-[(1R,2R,5S)-2-fluoro-5-[(4-fluorophenyl)sulfonylamino]cyclopentyl]hept-5-enoic acid (PubChem CID 15018459) has the molecular formula C18H23F2NO4S and a molecular weight of 387.45 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-2-fluoro-5-[(4-fluorophenyl)sulfonylamino]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,5S)-2-fluoro-5-[(4-fluorophenyl)sulfonylamino]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 15018459 |
| Molecular Formula | C18H23F2NO4S |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-2-fluoro-5-[(4-fluorophenyl)sulfonylamino]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@H](F)CC[C@@H]1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H23F2NO4S/c19-13-7-9-14(10-8-13)26(24,25)21-17-12-11-16(20)15(17)5-3-1-2-4-6-18(22)23/h1,3,7-10,15-17,21H,2,4-6,11-12H2,(H,22,23)/b3-1-/t15-,16+,17-/m0/s1 |
| InChIKey | FSSSDPWFJBFSRT-CIWJSOGRSA-N |
| XLogP | 3.42 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|