C26H31NO6S — CID 15018451
[(1S,2R,3S)-3-(benzenesulfonamido)-2-[(Z)-7-methoxy-7-oxohept-2-enyl]cyclopentyl] benzoate (PubChem CID 15018451) has the molecular formula C26H31NO6S and a molecular weight of 485.60 g/mol. Its IUPAC name is [(1S,2R,3S)-3-(benzenesulfonamido)-2-[(Z)-7-methoxy-7-oxohept-2-enyl]cyclopentyl] benzoate.
| Compound Name | [(1S,2R,3S)-3-(benzenesulfonamido)-2-[(Z)-7-methoxy-7-oxohept-2-enyl]cyclopentyl] benzoate |
|---|---|
| PubChem CID | 15018451 |
| Molecular Formula | C26H31NO6S |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | [(1S,2R,3S)-3-(benzenesulfonamido)-2-[(Z)-7-methoxy-7-oxohept-2-enyl]cyclopentyl] benzoate |
| SMILES | COC(=O)CCC/C=C\C[C@@H]1[C@@H](NS(=O)(=O)c2ccccc2)CC[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H31NO6S/c1-32-25(28)17-11-3-2-10-16-22-23(27-34(30,31)21-14-8-5-9-15-21)18-19-24(22)33-26(29)20-12-6-4-7-13-20/h2,4-10,12-15,22-24,27H,3,11,16-19H2,1H3/b10-2-/t22-,23+,24+/m1/s1 |
| InChIKey | QJUSIIDGRYCOEU-HVEQHSJMSA-N |
| XLogP | 4.26 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|