C19H26FNO4S — CID 67916513
methyl (Z)-6-[(1R,2S,5R)-2-(benzenesulfonamidomethyl)-5-fluorocyclopentyl]hex-4-enoate (PubChem CID 67916513) has the molecular formula C19H26FNO4S and a molecular weight of 383.49 g/mol. Its IUPAC name is methyl (Z)-6-[(1R,2S,5R)-2-(benzenesulfonamidomethyl)-5-fluorocyclopentyl]hex-4-enoate.
| Compound Name | methyl (Z)-6-[(1R,2S,5R)-2-(benzenesulfonamidomethyl)-5-fluorocyclopentyl]hex-4-enoate |
|---|---|
| PubChem CID | 67916513 |
| Molecular Formula | C19H26FNO4S |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | methyl (Z)-6-[(1R,2S,5R)-2-(benzenesulfonamidomethyl)-5-fluorocyclopentyl]hex-4-enoate |
| SMILES | COC(=O)CC/C=C\C[C@@H]1[C@@H](CNS(=O)(=O)c2ccccc2)CC[C@H]1F |
| InChI | InChI=1S/C19H26FNO4S/c1-25-19(22)11-7-3-6-10-17-15(12-13-18(17)20)14-21-26(23,24)16-8-4-2-5-9-16/h2-6,8-9,15,17-18,21H,7,10-14H2,1H3/b6-3-/t15-,17-,18-/m1/s1 |
| InChIKey | VYHFQIGFXVQCNX-CAXUFITISA-N |
| XLogP | 3.23 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|